| Primary information |
|---|
| ID | 20608 |
| Pubchem ID | NA |
| Name | Prostaglandin F2a |
| Description | Prostaglandin F2a (PGF2) is one of the earliest discovered and most common prostaglandins. It is actively biosynthesized in various organs of mammals and exhibits a variety of biological activities; including contraction of pulmonary arteries. It is used in medicine to induce labor and as an abortif |
| Synonym | (+)-Prostaglandin F2a; (5Z;13E)-(15S)-9-alpha;11-alpha;15-Trihydroxyprosta-5;13-dienoate; (5Z;13E)-(15S)-9-alpha;11-alpha;15-Trihydroxyprosta-5;13-dienoic acid; (5Z;13E;15S)-9a;11a;15-Trihydroxyprosta |
| Molecular Weight | 354.481 |
| Formula | NA |
| IUPAC | (5E)-7-[(1R;2R;3R;5S)-3;5-dihydroxy-2-[(1E;3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]hept-5-enoic acid |
| SMILE | CCCCC[C@H](O)C=C[C@H]1[C@H](O)C[C@H](O)[C@@H]1CC=CCCCC(O)=O |
| PDB ID | NA |
| KEGG | C00639 |
| HMDB ID | HMDB0001139 |
| Melting Point (Degree C) | 30 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q62786; Q9P2B2; Q9WV91; P37289 |
| Reference | HMDB
|