| Primary information |
|---|
| ID | 20605 |
| Pubchem ID | NA |
| Name | Leukotriene B5 |
| Description | Leukotriene B5 (LTB5) is a 5-lipoxygenase metabolite of arachidonic (AA) and eicosapentaenoic acid (EPA); involved in numerous inflammatory diseases and possesses a substantially less potent inflammatory effect than LTB4. Binding of LTB5 to human neutrophil LTB4 high affinity binding sites is lower |
| Synonym | (5S;6Z;8E;10E;12R;14Z)-5;12-Dihydroxy-6;8;10;14;17-eicosapentaenoic acidChEBI5;12-DiHEPEChEBILTB5ChEBI(5S;6Z;8E;10E;12R;14Z)-5;12-Dihydroxy-6;8;10;14;17-eicosapentaenoateGenerator5;12-Dihydroxy-6-tran |
| Molecular Weight | 334.4498 |
| Formula | NA |
| IUPAC | (5S;6Z;8E;10E;12R;14Z;17Z)-5;12-dihydroxyicosa-6;8;10;14;17-pentaenoic acid |
| SMILE | CCC=C/CC=C/C[C@@H](O)C=CC=CC=C/[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0005073 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|