| Primary information |
|---|
| ID | 20599 |
| Pubchem ID | NA |
| Name | 6-Keto-prostaglandin F1a |
| Description | 6-keto-Prostaglandin F1a is the physiologically active and stable metabolite of prostacyclin. (A prostaglandin found in nearly all mammalian tissue that is a powerful vasodilator and inhibits platelet aggregation; it is biosynthesized enzymatically from prostaglandin endoperoxides in human vascular |
| Synonym | 6-Keto-PGF1aChEBI6-Keto-PGF1alphaChEBI6-Keto-prostaglandin F1alphaChEBI6-Ketoprostaglandin F1alphaChEBI6-oxo-PGF1alphaChEBI6-oxo-Prostaglandin F1alphaChEBI6-Keto-PGF1αGenerator6-Keto-prostaglandin F1α |
| Molecular Weight | 370.4804 |
| Formula | NA |
| IUPAC | 7-[(1R;2R;3R;5S)-3;5-dihydroxy-2-[(1E;3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl]-6-oxoheptanoic acid |
| SMILE | CCCCC[C@H](O)C=C[C@H]1[C@H](O)C[C@H](O)[C@@H]1CC(=O)CCCCC(O)=O |
| PDB ID | NA |
| KEGG | C05961 |
| HMDB ID | HMDB0002886 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|