| Primary information |
|---|
| ID | 20597 |
| Pubchem ID | NA |
| Name | 5-KETE |
| Description | 5-KETE; also known as 5-keto-ete or 5-oxoete; belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Thus; 5-KETE is considered to be an eicosanoid. Based on a literature review a significa |
| Synonym | (6E;8Z;11Z;14Z)-5-Oxoicosa-6;8;11;14-tetraenoic acidChEBI5-Keto-eteChEBI5-Ketoeicosatetraenoic acidChEBI5-oxo; 6t;8C;11C;14C-20:4ChEBI5-oxo-6(e);8(Z);11(Z);14(Z)-Eicosatetraenoic acidChEBI5-oxo-6E;8Z; |
| Molecular Weight | 318.4504 |
| Formula | NA |
| IUPAC | (6E;8Z;11Z;14Z)-5-oxoicosa-6;8;11;14-tetraenoic acid |
| SMILE | CCCCCC=C/CC=C/CC=C/C=C/C(=O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C14732 |
| HMDB ID | HMDB0010217 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|