| Primary information |
|---|
| ID | 20594 |
| Pubchem ID | NA |
| Name | 20-Carboxy-leukotriene B4 |
| Description | 20-Carboxyleukotriene B4 is an omega-oxidized metabolite of leukotriene B4 (LTB4). Neutrophil microsomes are known to oxidize 20-hydroxy-LTB4 (20-OH-LTB4) to its 20-oxo and 20-carboxy derivatives in the presence of NADPH. |
| Synonym | 20-Carboxy-LTB4ChEBI20-COOH-Leukotriene b4ChEBI20-COOH-LTB4ChEBI5;12-Dihydroxy-delta5;8;11;14-eicosapolyendioic acidChEBI5;12-Dihydroxy-delta5;8;11;14-eicosapolyendioateGenerator5;12-Dihydroxy-δ5;8;11 |
| Molecular Weight | 366.4486 |
| Formula | NA |
| IUPAC | (5S;6Z;8E;10E;12R;14Z)-5;12-dihydroxyicosa-6;8;10;14-tetraenedioic acid |
| SMILE | O[C@@H](CCCC(O)=O)C=C/C=C/C=C/[C@H](O)CC=C/CCCCC(O)=O |
| PDB ID | NA |
| KEGG | C05950 |
| HMDB ID | HMDB0006059 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|