| Primary information |
|---|
| ID | 20593 |
| Pubchem ID | NA |
| Name | 2-Arachidonyl Glycerol ether |
| Description | 2-Arachidonyl glycerol ether (2-AG ether) has been isolated from porcine brain and its structure determined by mass spec analysis.1 2-AG ether has also been synthesized as an analog of the endogenous cannabinoid (CB); 2-AG; for structure activity testing.2 2-AG ether is a selective central cannabino |
| Synonym | (5Z;8Z;11Z;14Z)-Icosatetraenyl-2-glyceryl etherChEBI2-(5Z;8Z;11Z;14Z-Eicosatetraenyl)-sn-glycerolChEBI2-AG etherChEBI2-O-(5Z;8Z;11Z;14Z)-EicosatetraenylglycerolChEBI5Z;8Z;11Z;14Z-Eicosatetraen-2-glyce |
| Molecular Weight | 364.5619 |
| Formula | NA |
| IUPAC | 2-[(5Z;8Z;11Z;14Z)-icosa-5;8;11;14-tetraen-1-yloxy]propane-1;3-diol |
| SMILE | CCCCCC=C/CC=C/CC=C/CC=C/CCCCOC(CO)CO |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0013657 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|