| Primary information |
|---|
| ID | 20592 |
| Pubchem ID | NA |
| Name | MG(0:0/20:4(5Z;8Z;11Z;14Z)/0:0) |
| Description | MG(0:0/20:4(5Z;8Z;11Z;14Z)/0:0); also known as 2-arachidonoylglycerol (2-AG); is a unique molecular species of monoacylglycerol isolated in 1995 from rat brain and canine gut as an endogenous ligand for the cannabinoid receptors. 2-AG is rapidly formed from arachidonic acid-containing phospholipids |
| Synonym | 2-(5Z;8Z;11Z;14Z-Eicosatetraenoyl)-glycerolChEBI2-AGChEBI2-Ara-GLChEBI2-Arachidonoyl-glycerolChEBI2-Arachidonyl-glycerolChEBI2-Arachidonoyl-sn-glycerolKegg(5Z;8Z;11Z;14Z)-2-Hydroxy-1-(hydroxymethyl)et |
| Molecular Weight | 378.5454 |
| Formula | C23H38O4 |
| IUPAC | 1;3-dihydroxypropan-2-yl (5Z;8Z;11Z;14Z)-icosa-5;8;11;14-tetraenoate |
| SMILE | [H]C(CO)(CO)OC(=O)CCCC=C/CC=C/CC=C/CC=C/CCCCC |
| PDB ID | NA |
| KEGG | C13856 |
| HMDB ID | HMDB0004666 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|