| Primary information |
|---|
| ID | 20585 |
| Pubchem ID | 625380 |
| Name | 5-androstene-3;17-dione |
| Description | 5-androstene-3;17-dione belongs to androgens and derivatives class of compounds. Those are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. |
| Synonym | NA |
| Molecular Weight | 286.415 |
| Formula | C19H26O2 |
| IUPAC | 2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-ene-5;14-dione |
| SMILE | CC12CCC3C(CC=C4CC(=O)CCC34C)C1CCC2=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0304212 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|