Primary information |
---|
ID | 20582 |
Pubchem ID | 160531 |
Name | androst-5-ene-3;17-dione |
Description | androst-5-ene-3;17-dione; also known as delta5-ADD or δ5-add; is classified as an androgen or an Androgen derivative. Androgens are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. |
Synonym | 5-Androstene-3;17-dione;Delta(5)-Androstene-3;17-dione;delta5-Androstene-3;17-dione;Δ(5)-androstene-3;17-dione;Δ5-androstene-3;17-dione;5-Androstene-3;17-dione;Delta(5)-Androstene-3;17-dione;delta5-An |
Molecular Weight | 286.415 |
Formula | C19H26O2 |
IUPAC | (1S;2R;10R;11S;15S)-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-ene-5;14-dione |
SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2CC(=O)CC[C@]12C |
PDB ID | NA |
KEGG | C20252 |
HMDB ID | HMDB0062415 |
Melting Point (Degree C) | NA |
Water Solubility | 0.037 g/l |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|