| Primary information |
|---|
| ID | 20574 |
| Pubchem ID | 131753126 |
| Name | Alectrol |
| Description | Alectrol is found in cowpea. Alectrol is isolated from the roots of Vigna unguiculata (genuine host plant for Alectra species) Strigolactones are plant hormones that have been implicated in inhibition of shoot branching. |
| Synonym | Alectrol;Alectrol; |
| Molecular Weight | 346.3744 |
| Formula | C19H22O6 |
| IUPAC | 5-{[(3Z)-8a-hydroxy-8;8-dimethyl-2-oxo-2H;3H;3aH;5H;6H;7H;8H;8aH;8bH-indeno[1;2-b]furan-3-ylidene]methoxy}-3-methyl-2;5-dihydrofuran-2-one |
| SMILE | CC1=CC(OC=C2C3C=C4CCCC(C)(C)C4(O)C3OC2=O)OC1=O |
| PDB ID | NA |
| KEGG | C09059 |
| HMDB ID | HMDB0041372 |
| Melting Point (Degree C) | NA |
| Water Solubility | 4755 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|