| Primary information |
|---|
| ID | 20569 |
| Pubchem ID | 131751296 |
| Name | Nb-trans-p-Coumaroylserotonin glucoside |
| Description | Nb-trans-p-Coumaroylserotonin glucoside is found in fats and oils. It is an alkaloid from Carthamus tinctorius (safflower) If neurons that make serotonin serotonergic neurons are abnormal in infants; there is a risk of sudden infant death syndrome (SIDS). |
| Synonym | 5-Hydroxytryptamine;(2E)-3-(4-Hydroxyphenyl)-N-[2-(5-{[3;4;5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1H-indol-3-yl)ethyl]prop-2-enimidate;5-Hydroxytryptamine;(2E)-3-(4-Hydroxyphenyl)-N-[2-(5-{[3;4; |
| Molecular Weight | 484.4984 |
| Formula | C25H28N2O8 |
| IUPAC | (2E)-3-(4-hydroxyphenyl)-N-[2-(5-{[3;4;5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILE | OCC1OC(OC2=CC3=C(NC=C3CCNC(=O)C=CC3=CC=C(O)C=C3)C=C2)C(O)C(O)C1O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0032760 |
| Melting Point (Degree C) | 240 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|