| Primary information |
|---|
| ID | 20561 |
| Pubchem ID | 5280980 |
| Name | Clavulanate |
| Description | Clavulanate; also known as acido clavulanico or clavulansaeure; belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon); or a deriv |
| Synonym | (2R;3Z;5R)-3-(2-HYDROXYETHYLIDENE)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylIC ACID;(Z)-(2R;5R)-3-(2-Hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo(3.2.0)heptane-2-carboxylic acid;Acide clavulani |
| Molecular Weight | 199.1608 |
| Formula | C8H9NO5 |
| IUPAC | (2R;3Z;5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILE | [H][C@@]12CC(=O)N1[C@@H](C(O)=O)C(O2)=CCO |
| PDB ID | NA |
| KEGG | C06662 |
| HMDB ID | HMDB0014904 |
| Melting Point (Degree C) | 172 |
| Water Solubility | 337 g/L |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|