| Primary information |
|---|
| ID | 20551 |
| Pubchem ID | 53481610 |
| Name | 7-Dehydropregnenolone |
| Description | 7-Dehydropregnenolone is a 21-carbon steroid; derived from cholesterol and found in steroid hormone-producing tissues. It is the precursor to Gonadal steroid hormones and the adrenal corticosteroid. 7-Dehydropregnenolone is the the single product of metabolism of 7-dehydrocholesterol by CYP11A1 |
| Synonym | 7-DHP;7-Dehydropregnenolone;7-DHP;7-Dehydropregnenolone;7-Dehydropregnenolone |
| Molecular Weight | 314.4617 |
| Formula | C21H30O2 |
| IUPAC | 1-[(2R;5S;15S)-5-hydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-7;9-dien-14-yl]ethan-1-one |
| SMILE | CC(=O)C1CCC2C3=CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0013121 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|