| Primary information |
|---|
| ID | 20535 |
| Pubchem ID | 53477892 |
| Name | CE(20:3(8Z;11Z;14Z)) |
| Description | Cholesteryl eicosatrienoic acid is a cholesteryl ester. A cholesteryl ester is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes o |
| Synonym | 20:3 Cholesterol ester;Cholest-5-en-3beta-yl (8Z;11Z;14Z-eicosatrienoate;Cholest-5-en-3beta-yl (8Z;11Z;14Z-eicosatrienoate);Cholest-5-en-3beta-yl (8Z;11Z;14Z-eicosatrienoic acid;Cholesteryl eicosatrie |
| Molecular Weight | 675.121 |
| Formula | C47H78O2 |
| IUPAC | (2R;5S;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-yl (8Z;11Z;14Z)-icosa-8;11;14-trienoate |
| SMILE | CCCCCC=C/CC=C/CC=C/CCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CCC3C4CCC([C@H](C)CCCC(C)C)[C@@]4(C)CCC23)C1 |
| PDB ID | NA |
| KEGG | C02530 |
| HMDB ID | HMDB0006736 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|