| Primary information |
|---|
| ID | 20534 |
| Pubchem ID | 53477895 |
| Name | CE(20:2(6Z;9Z)) |
| Description | Cholesteryl eicosadienoic acid is a cholesteryl ester. A cholesteryl ester is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes of |
| Synonym | LacCer(D18:1/16:0);N-(Hexadecanoyl)-1-b-lactosyl-sphing-4-enine;1-O-(4-O-b-D-Galactopyranosyl-b-D-glucopyranosyl)-ceramide;1-O-(4-O-beta-D-Galactopyranosyl-beta-glucopyranosyl)ceramide;1-O-(4-O-beta-d |
| Molecular Weight | 677.1369 |
| Formula | C47H80O2 |
| IUPAC | (2R;5S;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-yl (11Z;14Z)-icosa-11;14-dienoate |
| SMILE | CCCCCC=C/CC=C/CCCCCCCCCC(=O)O[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(CCC4C3CC=C2C1)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C01290 |
| HMDB ID | HMDB0006734 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|