| Primary information |
|---|
| ID | 20532 |
| Pubchem ID | 53477889 |
| Name | CE(20:5(5Z;8Z;11Z;14Z;17Z)) |
| Description | Cholesteryl eicosapentaenoic acid is a cholesteryl ester. A cholesteryl ester is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes |
| Synonym | (3b)-Cholest-5-en-3-ol (5Z;8Z;11Z;14Z;17Z)-5;8;11;14;17-eicosapentaenoate;(3b)-Cholest-5-en-3-ol (5Z;8Z;11Z;14Z;17Z)-5;8;11;14;17-eicosapentaenoic acid;(3b)-Cholest-5-en-3-ol (all-Z)-5;8;11;14;17-ei |
| Molecular Weight | 671.0893 |
| Formula | C47H74O2 |
| IUPAC | (2R;5S;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-yl (5Z;8Z;11Z;14Z;17Z)-icosa-5;8;11;14;17-pentaenoate |
| SMILE | CCC=C/CC=C/CC=C/CC=C/CC=C/CCCC(=O)O[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(CCC4C3CC=C2C1)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C02530 |
| HMDB ID | HMDB0006731 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|