| Primary information |
|---|
| ID | 20525 |
| Pubchem ID | 12303099 |
| Name | 5;6-trans-Vitamin D3 |
| Description | 5;6-trans-vitamin D3 is the result of photodegradation of vitamin D3; and once formed in the skin; exposure to sunlight results in its rapid photodegradation to a variety of photoproducts. During chronic exposure to sunlight vitamin D3 in the skin can be photoisomerized to a variety of photoproducts |
| Synonym | 3-[(2E)-2-[(1R;3AS;7ar)-1-[(1R)-1;5-dimethylhexyl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylene-cyclohexanol;5;6-trans-Cholecalciferol;trans-Vitamin D3;3-[(2E)-2-[(1R;3AS;7ar)-1-[(1R) |
| Molecular Weight | 384.6377 |
| Formula | C27H44O |
| IUPAC | (1S;3E)-3-{2-[(1R;4E;7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexan-1-ol |
| SMILE | CC(C)CCC[C@@H](C)[C@H]1CCC2([H])C(CCC[C@]12C)=CC=C1/C[C@@H](O)CCC1=C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0006719 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|