| Primary information |
|---|
| ID | 20524 |
| Pubchem ID | 111049 |
| Name | Lumisterol 3 |
| Description | Lumisterol 3 is a normal human secosterooid metabolite from the class of vitamin D3 photoisomer derivatives. It is synthesized from 7-Dehydrocholesterol in the epidermis in response to ultraviolet irradiation. When human skin is exposed to ultraviolet radiation; epidermal 7-dehydrocholesterol is con |
| Synonym | (3b;9b;10a)-Cholesta-5;7-dien-3-ol;9b;10a-Cholesta-5;7-dien-3b-ol;9beta;10alpha-Cholesta-5;7-dien-3beta-ol;(3b;9b;10a)-Cholesta-5;7-dien-3-ol;9b;10a-Cholesta-5;7-dien-3b-ol;9beta;10alpha-Cholesta-5;7- |
| Molecular Weight | 384.6377 |
| Formula | C27H44O |
| IUPAC | (1R;2S;5S;11R;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-7;9-dien-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])C3=CC=C4C[C@@H](O)CC[C@@]4(C)[C@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0006505 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|