| Primary information |
|---|
| ID | 20523 |
| Pubchem ID | 11199982 |
| Name | Previtamin D3 |
| Description | Previtamin D3; also known as tachysterol(3) or precalciferol; belongs to the class of organic compounds known as vitamin d and derivatives. Vitamin D and derivatives are compounds containing a secosteroid backbone; usually secoergostane or secocholestane. Based on a literature review very few articl |
| Synonym | (3beta;6Z)-9;10-Secocholesta-5(10);6;8-trien-3-ol;(6Z)-(3S)-9;10-Seco-5(10);6;8-cholestatrien-3-ol;Previtamin D(3);Previtamin d_3 / precholecalciferol / (6Z)-tacalciol;Previtamin D(3); (3beta;6E)-isom |
| Molecular Weight | 384.6377 |
| Formula | C27H44O |
| IUPAC | (1S)-3-[(Z)-2-[(1R;7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2;3;3a;6;7;7a-hexahydro-1H-inden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol |
| SMILE | CC(C)CCC[C@@H](C)[C@H]1CCC2([H])C(=CCC[C@]12C)C=C/C1=C(C)CC[C@H](O)C1 |
| PDB ID | NA |
| KEGG | C07711 |
| HMDB ID | HMDB0006500 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|