| Primary information |
|---|
| ID | 20521 |
| Pubchem ID | 440711 |
| Name | 20alpha-Hydroxycholesterol |
| Description | 20alpha-Hydroxycholesterol belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. Thus; 20alpha-hydroxycholesterol is considered to be a sterol. Based on a literature review very few art |
| Synonym | 20a-Hydroxycholesterol;20Α-hydroxycholesterol;(20S)-20-Hydroxycholesterol;(20S)-Cholest-5-ene-3 beta;20-diol;20 alpha-Hydroxycholesterol;20-Hydroxycholesterol;20-Hydroxycholesterol; (3beta;20 xi)-isom |
| Molecular Weight | 402.6529 |
| Formula | C27H46O2 |
| IUPAC | (1S;2R;5S;10S;11S;14S;15S)-14-[(2R)-2-hydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-ol |
| SMILE | CC(C)CCC[C@@](C)(O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| PDB ID | NA |
| KEGG | C05500 |
| HMDB ID | HMDB0006283 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|