| Primary information |
|---|
| ID | 20520 |
| Pubchem ID | 440985 |
| Name | 7-a;27-Dihydroxycholesterol |
| Description | 7-a;27-Dihydroxycholesterol; also known as cholest-5-ene-3b;7a;26-triol; belongs to the class of organic compounds known as trihydroxy bile acids; alcohols and derivatives. These are prenol lipids structurally characterized by a bile acid or alcohol which bears three hydroxyl groups. |
| Synonym | 5-Cholestene-3beta;7alpha;26-triol;7-alpha;27-Dihydroxycholesterol;Cholest-5-ene-3beta;7alpha;26-triol;Cholest-5-ene-3beta;7alpha;27-triol;5-Cholestene-3b;7a;26-triol;5-Cholestene-3β;7α;26-triol;7-Α;2 |
| Molecular Weight | 418.6523 |
| Formula | C27H46O3 |
| IUPAC | (1S;2R;5S;9S;10S;11S;14R;15R)-14-[(2R)-7-hydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-ene-5;9-diol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)CO |
| PDB ID | NA |
| KEGG | C06341 |
| HMDB ID | HMDB0006281 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|