| Primary information |
|---|
| ID | 20519 |
| Pubchem ID | 92746 |
| Name | Zymosterol intermediate 2 |
| Description | Zymosterol is the precursor of cholesterol and is found in the plasma membrane. zymosterol circulates within the cells. The structural features of zymosterol provided optimal substrate acceptability. In human fibroblasts; zymosterol is converted to cholesterol solely in the rough ER. |
| Synonym | 5alpha-Cholesta-8;24-dien-3beta-ol;delta8;24-Cholestadien-3beta-ol;Zymostrol;5a-Cholesta-8;24-dien-3b-ol;5Α-cholesta-8;24-dien-3β-ol;delta8;24-Cholestadien-3b-ol;Δ8;24-cholestadien-3β-ol;Zymosterol in |
| Molecular Weight | 384.6377 |
| Formula | C27H44O |
| IUPAC | (2S;5S;7S;11R;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-1(10)-en-5-ol |
| SMILE | [H][C@@](C)(CCC=C(C)C)[C@@]1([H])CC[C@@]2([H])C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C[C@]1([H])CC3 |
| PDB ID | NA |
| KEGG | C05437 |
| HMDB ID | HMDB0006271 |
| Melting Point (Degree C) | 110 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|