| Primary information |
|---|
| ID | 20518 |
| Pubchem ID | 18603089 |
| Name | 6beta-Hydroxytestosterone |
| Description | DG(O-16:0/18:0/0:0) belongs to the family of Diacylglycerols. These are glycerolipids lipids containing a common glycerol backbone to which at least one fatty acyl group is esterified. DG(O-16:0/18:0/0:0) is also a substrate of diacylglycerol kinase. It is involved in the phospholipid metabolic path |
| Synonym | 2-Octadecanoyl-1-hexadecyl-sn-glycerol;(6beta;17beta)-6;17-Dihydroxyandrost-4-en-3-one;4-Androsten-6beta;17beta-diol-3-one;6beta;17beta-Dihydroxy-4-androsten-3-one;6beta;17beta-Dihydroxyandrost-4-en-3 |
| Molecular Weight | 304.4238 |
| Formula | C19H28O3 |
| IUPAC | (1S;2R;8R;10R;11S;14S;15S)-8;14-dihydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-en-5-one |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C[C@@H](O)C2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0006259 |
| Melting Point (Degree C) | 172 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|