| Primary information |
|---|
| ID | 20517 |
| Pubchem ID | 53477807 |
| Name | 25-Hydroxycholesterol |
| Description | 25-Hydroxycholesterol is steroid derivative that suppresses the cleavage of sterol regulatory element binding proteins (SREBPs). It also induces apoptosis through down-regulation of Bcl-2 expression and activation of caspases. 25-Hydroxycholesterol also enhances Interleukin-1 beta (IL-1beta-induced) |
| Synonym | (beta)-Cholest-5-ene-3-25-diol;25-Hydroxy-cholesterol;25-Hydroxycholest-5-en-3-ol;5-Cholestene-3beta-25-diol;Cholest-5-en-3beta-25-diol;Cholest-5-ene-3-b;25-diol;Cholest-5-ene-3-beta;25-diol;Cholest-5 |
| Molecular Weight | 402.6529 |
| Formula | C27H46O2 |
| IUPAC | (2R;5S;10S;14R;15R)-14-[(2R)-6-hydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-ol |
| SMILE | [H]C12CC[C@H]([C@H](C)CCCC(C)(C)O)[C@@]1(C)CCC1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C15519 |
| HMDB ID | HMDB0006247 |
| Melting Point (Degree C) | 172 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|