| Primary information |
|---|
| ID | 20515 |
| Pubchem ID | 5283748 |
| Name | 24R;25-Dihydroxyvitamin D3 |
| Description | 24R;25-Dihydroxyvitamin D3; also known as 24(R);25(OH)2D3; is a vitamin D metabolite; a dihydroxylated form of the seco-steroid. With the identification of a target cell; the growth plate resting zone (RC) chondrocyte; studies indicate that there are specific membrane-associated signal transduction |
| Synonym | (24R)-24;25-Dihydroxycholecalciferol;(24R)-24;25-Dihydroxyvitamin D3;24(R);25-Dihydroxyvitamin D3;24R;25(OH)2D3;24R;25-Dihydroxycholecalciferol;Secalciferol;Osteo D;24;25-Dihydroxycholecalciferol;24;2 |
| Molecular Weight | 416.646 |
| Formula | C27H44O3 |
| IUPAC | (3R;6R)-6-[(1R;3aS;4E;7aR)-4-{2-[(1Z;5S)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene}-7a-methyl-octahydro-1H-inden-1-yl]-2-methylheptane-2;3-diol |
| SMILE | [H][C@@]1(CC[C@@]2([H])C(CCC[C@]12C)=CC=C1C[C@@H](O)CCC1=C)[C@H](C)CC[C@@H](O)C(C)(C)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0006226 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|