| Primary information |
|---|
| ID | 20511 |
| Pubchem ID | 53477798 |
| Name | Epimetendiol |
| Description | Epimetendiol is one of the major urinary metabolites of the anabolic androgenic compound metandienone. Anabolic-androgenic steroids such as metandienone are some of the most frequently detected drugs in amateur and professional sports. |
| Synonym | (3a;5b;17a)-17-Methyl-androst-1-ene-3;17-diol;17-Epimetendiol;17b-Methyl-5b-androst-1-ene-3a;17a-diol;(3a;5b;17a)-17-Methyl-androst-1-ene-3;17-diol;17-Epimetendiol;17b-Methyl-5b-androst-1-ene-3a;17a-d |
| Molecular Weight | 318.4935 |
| Formula | C21H34O2 |
| IUPAC | (1S;2R;5S;7R;10R;11S;14R;15S)-2;7;14;15-tetramethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-3-ene-5;14-diol |
| SMILE | [H][C@@]12CC[C@@](C)(O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2(C)C[C@H](O)C=C[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0006012 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|