Primary information |
---|
ID | 20510 |
Pubchem ID | 65555 |
Name | Tetrahydrodeoxycortisol |
Description | Tetrahydrodeoxycortisol (THS) is a mineralocorticoid; the main urinary metabolite of 11-deoxycortisol. THS excretion is significantly associated with tetrahydroaldosterone excretion; total androgen excretion; and cortisol metabolites. Aldosterone synthesis is highly heritable and is affected by geno |
Synonym | Tetrahydro-11-deoxycortisol;11-Deoxytetrahydrocortisol;3alpha;17alpha;21-Trihydroxy-5beta-pregnan-20-one;5beta-Pregnane-3alpha;17alpha;21-triol-20-one;tetrahydro-S;Tetrahydrocortexolone;5 beta-Pregnan |
Molecular Weight | 350.4923 |
Formula | C21H34O4 |
IUPAC | 1-[(1S;2S;5R;7R;10R;11S;14R;15S)-5;14-dihydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-14-yl]-2-hydroxyethan-1-one |
SMILE | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
PDB ID | NA |
KEGG | C14594 |
HMDB ID | HMDB0005972 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|