| Primary information |
|---|
| ID | 20509 |
| Pubchem ID | 134506 |
| Name | Dehydroandrosterone |
| Description | Dehydroandrosterone is a normal human androgen. It has been found dehydroandrosterone and other androgens excretion is affected by seasonal rhythms changes. In a study of patients with peptic ulcer in the stage of remission; their androgen levels were higher both in summer and winter; but in the spr |
| Synonym | 3a-Hydroxy-5-androsten-17-one;3a-Hydroxy-androst-5-en-17-one;Androst-5-en-3a-ol-17-one;D5-Androstene-3a-ol-17-one;Isoandrostenolone;Androstenolone;Dehydroisoandrosterone;5 Androsten 3 beta hydroxy 17 |
| Molecular Weight | 288.4244 |
| Formula | C19H28O2 |
| IUPAC | (1S;2R;5R;10R;11S;15S)-5-hydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-14-one |
| SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0005962 |
| Melting Point (Degree C) | 148 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|