| Primary information |
|---|
| ID | 20508 |
| Pubchem ID | 101989 |
| Name | Androstenol |
| Description | Androstenol is a steroidal compound belonging to the group of odorous 16-androstenes; first isolated from boar testes and also found in humans. Androstenol has pheromone-like properties in both animals and humans; but the molecular targets of its pheromonal activity are unknown. Androstenol as a phe |
| Synonym | (3alpha;5alpha)-Androst-16-en-3-ol;3alpha-Hydroxyandrost-16-ene;Androst-16-en-3alpha-ol;(3a;5a)-Androst-16-en-3-ol;(3Α;5α)-androst-16-en-3-ol;3a-Hydroxyandrost-16-ene;3Α-hydroxyandrost-16-ene;Androst- |
| Molecular Weight | 274.4409 |
| Formula | C19H30O |
| IUPAC | (1S;2S;5R;7S;10R;11S;15R)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-13-en-5-ol |
| SMILE | [H][C@@]12CC=C[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@]([H])(O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0005935 |
| Melting Point (Degree C) | 142.75 |
| Water Solubility | 3.64 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|