| Primary information |
|---|
| ID | 20507 |
| Pubchem ID | 92877 |
| Name | 5a-Androstan-3b-ol |
| Description | 5a-Androstan-3b-ol is a steroidal compound belonging to the group of odorous 16-androstenes; first isolated from boar testes and also found in humans. 5a-Androstan-3b-ol has pheromone-like properties in both animals and humans; but the molecular targets of its pheromonal activity are unknown. 5a-And |
| Synonym | (3.beta.;5.alpha.)-androstan-3-ol;(3b)-Androstan-3-ol;(3b;5a)-Androstan-3-ol;(3beta)-Androstan-3-ol;(3beta;5alpha)-Androstan-3-ol;3.beta.-hydroxy-5.alpha.-androstane;3b-Hydroxy-5a-androstane;5.alpha.- |
| Molecular Weight | 276.4568 |
| Formula | C19H32O |
| IUPAC | (1S;2S;5S;7S;10S;11S;15S)-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-5-ol |
| SMILE | [H][C@@]12CCC[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0005830 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|