| Primary information |
|---|
| ID | 20506 |
| Pubchem ID | 439451 |
| Name | beta-Cortol |
| Description | beta-Cortol is a normal androgen metabolite present in adults. It has been found in the urine of infants as well. beta-Cortol is the 5beta enantiomer of beta-allocortol. beta-Cortol levels are significantly higher in premenopausal women with leiomyomas than in age-matched healthy premenopausal contr |
| Synonym | b-Cortol;Β-cortol;(3alpha;5beta;11beta;20R) Pregnane-3;11;17;20;21-pentol;3alpha;11beta;17;20beta;21-Pentahydroxypregnane;5beta-Pregnan-3alpha;11beta;20;20beta;21-pentol;5beta-Pregnane-3alpha;11beta;1 |
| Molecular Weight | 368.5075 |
| Formula | C21H36O5 |
| IUPAC | (1S;2S;5R;7R;10S;11S;14R;15S;17S)-14-[(1R)-1;2-dihydroxyethyl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;14;17-triol |
| SMILE | [H][C@@]12CC[C@](O)([C@H](O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C01235 |
| HMDB ID | HMDB0005821 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|