| Primary information |
|---|
| ID | 20504 |
| Pubchem ID | 104810 |
| Name | CE(18:1(11Z)) |
| Description | CE(18:1(11Z)) is a cholesterol fatty acid ester or simply a cholesterol ester (CE). Cholesterol esters are cholesterol molecules with long-chain fatty acids linked to the hydroxyl group. They are much less polar than free cholesterol and appear to be the preferred form for transport in plasma and fo |
| Synonym | Ba(2+);Ba2+;BARIUM ion;Barium(2+);Ba;Cholesterol 1-(11Z-octadecenoic acid);Cholesteryl 1-(11Z-octadecenoic acid);1-Vaccenoyl-cholesterol;Cholesterol 1-vaccenoic acid;Cholesterol ester(18:1/0:0);Choles |
| Molecular Weight | 651.0996 |
| Formula | C45H78O2 |
| IUPAC | (2R;5S;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-yl (11Z)-octadec-11-enoate |
| SMILE | CCCCCCC=C/CCCCCCCCCC(=O)O[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(CCC4C3CC=C2C1)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C13881 |
| HMDB ID | HMDB0005189 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|