| Primary information |
|---|
| ID | 20503 |
| Pubchem ID | 444036 |
| Name | Fluticasone propionate |
| Description | Fluticasone propionate; a medium-potency synthetic corticosteroid; is used topically to relieve inflammatory and pruritic symptoms of dermatoses and psoriasis; intranasally to manage symptoms of allergic and non-allergic rhinitis; and orally for the treatment of asthma. |
| Synonym | Cutivate;Flonase;Flovent;Cutivic acid;Fluticasone propionic acid;Flovent diskus 250;Flovent diskus 50;CCI-18781cutivATE;Flovent diskus 100;Flovent hfa;FLUTICASONE;CCI 18781;CCI-18781cutivic acid;Asmat |
| Molecular Weight | 500.571 |
| Formula | C25H31F3O5S |
| IUPAC | (1R;2S;8S;10S;11S;13R;14R;15S;17S)-1;8-difluoro-14-{[(fluoromethyl)sulfanyl]carbonyl}-17-hydroxy-2;13;15-trimethyl-5-oxotetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-3;6-dien-14-yl propanoate |
| SMILE | [H][C@@]12C[C@@H](C)[C@](OC(=O)CC)(C(=O)SCF)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0005036 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|