| Primary information |
|---|
| ID | 20502 |
| Pubchem ID | 17150 |
| Name | Formebolone |
| Description | Formebolone is a synthetic anabolic steroid. It is suspected of misuse in sports and therefore tested for in regular screening of athletes. The desire to artificially enhance physical performance in order to increase the chances to win in sports competition is supposedly as old as mankind itself. |
| Synonym | (11a;17b)-11;17-Dihydroxy-17-methyl-3-oxo-androsta-1;4-diene-2-carboxaldehyde;11a;17b-Dihydroxy-17-methyl-3-oxo-androsta-1;4-diene-2-carboxaldehyde;11a;17b-Dihydroxy-17-methyl-3-oxoandrosta-1;4-diene- |
| Molecular Weight | 344.4446 |
| Formula | C21H28O4 |
| IUPAC | (1S;2R;10S;11S;14S;15S;17R)-14;17-dihydroxy-2;14;15-trimethyl-5-oxotetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-3;6-diene-4-carbaldehyde |
| SMILE | [H][C@@]12CC[C@](C)(O)[C@@]1(C)C[C@@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C(C=O)=C[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0004631 |
| Melting Point (Degree C) | 209 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|