| Primary information |
|---|
| ID | 20500 |
| Pubchem ID | 167685 |
| Name | 22b-Hydroxycholesterol |
| Description | 22b-Hydroxycholesterol; also known as cholest-5-en-3b;22R-diol or 22(R)OH cholesterol; belongs to the class of organic compounds known as dihydroxy bile acids; alcohols and derivatives. Dihydroxy bile acids; alcohols and derivatives are compounds containing or derived from a bile acid or alcohol; an |
| Synonym | (3beta;22R)-Cholest-5-ene-3;22-diol;22beta-Hydroxycholesterol;22R-Hydroxycholesterol;Cholest-5-en-3beta;22R-diol;(22R)-22-Hydroxycholesterol;(3b;22R)-Cholest-5-ene-3;22-diol;(3Β;22R)-cholest-5-ene-3;2 |
| Molecular Weight | 402.6529 |
| Formula | C27H46O2 |
| IUPAC | (1S;2R;5S;10S;11S;14R;15S)-14-[(2S;3R)-3-hydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-ol |
| SMILE | [H][C@@]12CC[C@H]([C@H](C)[C@H](O)CCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C05502 |
| HMDB ID | HMDB0004035 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|