| Primary information |
|---|
| ID | 20498 |
| Pubchem ID | 222803 |
| Name | 21-Deoxycortisol |
| Description | Plasma 21-deoxycortisol (21DF) is an excellent marker of 21-hydroxylase deficiency. Currently; it is the only marker able to detect heterozygous carriers with 21-hydroxylase deficiency after Adrenocorticotropic Hormone (ACTH) stimulation. |
| Synonym | 11b;17-Dihydroxy-pregn-4-ene-3;20-dione;11b;17-Dihydroxy-progesterone;11b;17a-Dihydroxypregn-4-ene-3;20-dione;11b;17a-Dihydroxyprogesterone;21-Dehydrohydrocortisone;21-Deoxyhydrocortisone;21-Desoxycor |
| Molecular Weight | 346.4605 |
| Formula | C21H30O4 |
| IUPAC | (1S;2R;10S;11S;14R;15S;17R)-14-acetyl-14;17-dihydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-en-5-one |
| SMILE | [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)C[C@@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C05497 |
| HMDB ID | HMDB0004030 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|