| Primary information |
|---|
| ID | 20496 |
| Pubchem ID | 5326793 |
| Name | 3b;5a;6b-Cholestanetriol |
| Description | 3b;5a;6b-Cholestanetriol; also known as cholestane-3-b;5-a;6-b-triol; belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. |
| Synonym | 3beta;5alpha;6beta-Cholestanetriol;3beta;5alpha;6beta-Trihydroxycholestane;Cholestane-3-beta;5-alpha;6-beta-triol;Cholestane-3beta-5alpha;6beta-triol;3Β;5α;6β-cholestanetriol;3b;5a;6b-Trihydroxycholes |
| Molecular Weight | 420.6682 |
| Formula | C27H48O3 |
| IUPAC | (1S;2R;5S;7R;8R;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;7;8-triol |
| SMILE | [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C[C@@H](O)[C@@]2(O)C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C05425 |
| HMDB ID | HMDB0003990 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|