Primary information |
---|
ID | 20495 |
Pubchem ID | 53477776 |
Name | 7a-Hydroxytestosterone |
Description | 4-Hydroxytestosterone is the 17-hydroxylated analog to formestane. It is commercially available on the internet as anabolic steroid for oral self-administration and does not have any therapeutic indication. |
Synonym | (17beta)-4;17-Dihydroxy-androst-4-en-3-one;(3b;17a)-Androst-5-ene-3;17-diol;3b;17a-Dihydroxyandrost-5-ene;4;17beta-Dihydroxy-4-androstene-3-one;4-Androstene-7alpha-17beta-diol-3-one;4-OHT;7alpha-Hydro |
Molecular Weight | 304.4238 |
Formula | C19H28O3 |
IUPAC | (2R;14S;15S)-6;14-dihydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-en-5-one |
SMILE | C[C@]12CCC3C(CCC4=C(O)C(=O)CC[C@]34C)C1CC[C@@H]2O |
PDB ID | NA |
KEGG | C05291 |
HMDB ID | HMDB0003956 |
Melting Point (Degree C) | 155 |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|