| Primary information |
|---|
| ID | 20494 |
| Pubchem ID | 252379 |
| Name | 19-Hydroxyandrost-4-ene-3;17-dione |
| Description | 19-Hydroxyandrost-4-ene-3;17-dione; also known as 19-HAED; belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. |
| Synonym | 19-Hydroxyandrostenedione;19-Hydroxy-4-androstene-3;17-dione;19-Hydroxy-4-androstene-3;17-dione; 18O-labeled;19-HAED;19-Hydroxyandrostenedione;19-Hydroxy-4-androstene-3;17-dione;19-Hydroxy-4-androsten |
| Molecular Weight | 302.4079 |
| Formula | C19H26O3 |
| IUPAC | (1S;2S;10R;11S;15S)-2-(hydroxymethyl)-15-methyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-ene-5;14-dione |
| SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12CO |
| PDB ID | NA |
| KEGG | C05290 |
| HMDB ID | HMDB0003955 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|