Primary information |
---|
ID | 20493 |
Pubchem ID | 440558 |
Name | 7-Dehydrodesmosterol |
Description | 7-Dehydrodesmosterol is a sterol intermediate in the biosynthesis of steroids. 7-Dehydrodesmosterol is a substrate of the enzyme 24-dehydrocholesterol reductase (EC:1.3.1.72); an important enzyme in the biosynthesis of Cholesterol. |
Synonym | 24-Dehydroprovitamin D3;Cholesta-5;7;24-trien-3beta-ol;Cholesta-5;7;24-triene-3beta-ol;Cholesta-5;7;24-trien-3b-ol;Cholesta-5;7;24-trien-3β-ol;Cholesta-5;7;24-triene-3b-ol;Cholesta-5;7;24-triene-3β-ol |
Molecular Weight | 382.6218 |
Formula | C27H42O |
IUPAC | (1S;2R;5S;11R;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-7;9-dien-5-ol |
SMILE | [H][C@@]1(CC[C@@]2([H])C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC=C(C)C |
PDB ID | NA |
KEGG | C05107 |
HMDB ID | HMDB0003896 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|