| Primary information |
|---|
| ID | 20492 |
| Pubchem ID | 2723897 |
| Name | Cholesteryl acetate |
| Description | Cholesteryl acetate is a normal human cholesteryl ester present in diverse fluids and organs. Cholesteryl acetate is also present in foods. Food oxidation affects the quality and safety of the human diet by generating compounds with biological activities that can adversely affect health. |
| Synonym | (-)-Cholesteryl acetate;(3beta)-Cholest-5-en-3-ol acetate;3-Cholesteryl acetate;3beta-Acetoxycholest-5-ene;5-Cholesten-3beta-ol acetate;Cholest-5-en-3beta-ol acetate;Cholest-5-en-3beta-yl acetate;Chol |
| Molecular Weight | 428.701 |
| Formula | C29H48O2 |
| IUPAC | (1S;2R;5S;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-yl acetate |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)OC(C)=O)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0003822 |
| Melting Point (Degree C) | NA |
| Water Solubility | 9.7e-06 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|