Primary information |
---|
ID | 20491 |
Pubchem ID | 10634 |
Name | 5-Androstenediol |
Description | 5-Androstenediol is a direct metabolite of the most abundant steroid produced by the human adrenal cortex; dehydroepiandrosterone (DHEA). 5-Androstenediol is less androgenic than 4-androstenediol; and stimulates the immune system. |
Synonym | (3beta;17beta)-Androst-5-ene-3;17-diol;3beta;17beta-Dihydroxy-5-androstene;3beta;17beta-Dihydroxyandrost-5-ene;5-Androstenediol;Androst-5-en-3beta;17beta-diol;Androst-5-enediol;Hermaphrodiol;Androst-5 |
Molecular Weight | 290.4403 |
Formula | C19H30O2 |
IUPAC | (1S;2R;5S;10R;11S;14S;15S)-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-ene-5;14-diol |
SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C |
PDB ID | NA |
KEGG | C04295 |
HMDB ID | HMDB0003818 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|