| Primary information |
|---|
| ID | 20490 |
| Pubchem ID | 440114 |
| Name | Etiocholanedione |
| Description | Etiocholanedione is a 5-beta metabolite product of the catabolism of androgens. Etiocholanedione has been identified as a ketosteroid and isolated from the urine of healthy and diseased persons. |
| Synonym | Etiocholane-3;17-dione;Etiocholanedione;(5b)-Androstane-3;17-dione;5b-Androstane-3;17-dione;5b-Androstanedione;5beta-Androstane-3;17-dione;Etiochola-3;17-dione;Etiocholane-3;17-dione;Etiocholanedione; |
| Molecular Weight | 288.4244 |
| Formula | C19H28O2 |
| IUPAC | (1S;2S;7R;10R;11S;15S)-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;14-dione |
| SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2([H])CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C03772 |
| HMDB ID | HMDB0003769 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|