| Primary information |
|---|
| ID | 20488 |
| Pubchem ID | 4225619 |
| Name | CE(10:0) |
| Description | Cholesteryl decanoate is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes of all body tissues; and transported in the blood plasm |
| Synonym | 3b-(Decanoyloxy)-5-cholestene;5-Cholesten-3b-ol caprate;Cholest-5-en-3b-ol caprate;Cholesterol 3-decanoate;Cholesterol 3-decanoic acid;Cholesterol caprate;Cholesterol decanoate;Cholesterol decanoic ac |
| Molecular Weight | 540.9029 |
| Formula | C37H64O2 |
| IUPAC | 2;15-dimethyl-14-(6-methylheptan-2-yl)tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-yl decanoate |
| SMILE | CCCCCCCCCC(=O)OC1CCC2(C)C3CCC4(C)C(CCC4C3CC=C2C1)C(C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C02530 |
| HMDB ID | HMDB0003603 |
| Melting Point (Degree C) | 79 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|