| Primary information |
|---|
| ID | 20487 |
| Pubchem ID | 439479 |
| Name | 3a;7a;12a-Trihydroxy-5b-cholestan-26-al |
| Description | 3alpha;7alpha;12alpha-Trihydroxy-5beta-cholestan-26-al is an intermediate in bile acid biosynthesis. Bile acids are steroid acids found predominantly in the bile of mammals. The distinction between different bile acids is minute; depending only on the presence or absence of hydroxyl groups on positi |
| Synonym | (3alpha;5beta;7alpha;12alpha)-3;7;12-Trihydroxycholestan-26-al;3;7;12-Trihydroxycholestan-26-al;(3a;5b;7a;12a)-3;7;12-Trihydroxycholestan-26-al;(3Α;5β;7α;12α)-3;7;12-trihydroxycholestan-26-al;(6R)-2-M |
| Molecular Weight | 434.6517 |
| Formula | C27H46O4 |
| IUPAC | (6R)-2-methyl-6-[(1S;2S;5R;7S;9R;10R;11S;14R;15R;16S)-5;9;16-trihydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-14-yl]heptanal |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCCC(C)C=O |
| PDB ID | NA |
| KEGG | C01301 |
| HMDB ID | HMDB0003533 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|