| Primary information |
|---|
| ID | 20486 |
| Pubchem ID | 111329 |
| Name | CE(5:0) |
| Description | Cholesteryl pentanoate is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes of all body tissues; and transported in the blood plas |
| Synonym | (3b)-Cholest-5-en-3-ol pentanoate;(3b)-Cholest-5-en-3-ol pentanoic acid;5-Cholesten-3b-ol valerate;Cholest-5-en-3b-ol valerate;Cholesterol pentanoate;Cholesterol pentanoic acid;Cholesterol valerate;Ch |
| Molecular Weight | 470.77 |
| Formula | C32H54O2 |
| IUPAC | (1S;2R;5S;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-yl pentanoate |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)OC(=O)CCCC)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C02530 |
| HMDB ID | HMDB0003442 |
| Melting Point (Degree C) | NA |
| Water Solubility | 2.9e-07 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|