| Primary information |
|---|
| ID | 20485 |
| Pubchem ID | 13472 |
| Name | Boldione |
| Description | Boldione is a direct precursor (prohormone) to the anabolic steroid boldenone (1;4-androstadiene-17beta-ol-3-one). It is advertised as a highly anabolic/androgenic compound promoting muscularity; enhancing strength and overall physical performance; and is available on the Internet and in health stor |
| Synonym | 1;4-Androstadiene-3;17-dione;1-Dehydroandrostenedione;ADD;ADT;Androstadienedione;Androst-1;4-diene-3;17-dione;Boldione;Androsta-1;4-diene-3; 17-dione;Androsta-1;4-diene-3;17-dione;Androstane-1;4-diene |
| Molecular Weight | 284.3927 |
| Formula | C19H24O2 |
| IUPAC | (1S;2R;10R;11S;15S)-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-3;6-diene-5;14-dione |
| SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@]12C |
| PDB ID | NA |
| KEGG | C20144 |
| HMDB ID | HMDB0003422 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|