| Primary information |
|---|
| ID | 20484 |
| Pubchem ID | NA |
| Name | Withanolide |
| Description | Withanolides; which are extracted from Withania somnifera; are employed in the treatment of arthritis and are known to be potent inhibitors of angiogenesis; inflammation and oxidative stress. Withanolides can indeed inhibit the activation of NF-κB and NF-κB-regulated gene expression; which could exp |
| Synonym | (4beta;5beta;6beta;22R)-5;6-Epoxy-4;20;22-trihydroxy-1-oxoergosta-2;24-dien-26-Oate;(4beta;5beta;6beta;22R)-5;6-Epoxy-4;20;22-trihydroxy-1-oxoergosta-2;24-dien-26-Oic acid;(4beta;5beta;6beta;22R)-5;6- |
| Molecular Weight | 470.5977 |
| Formula | C28H38O6 |
| IUPAC | (1S;2R;6S;9R;11S;12S;15S;16S)-15-[(1R)-1-[(2R)-4;5-dimethyl-6-oxo-3;6-dihydro-2H-pyran-2-yl]-1-hydroxyethyl]-6-hydroxy-2;16-dimethyl-8-oxapentacyclo[9.7.0.0²;⁷.0⁷;⁹.0¹²;¹⁶]octadec-4-en-3-one |
| SMILE | [H][C@@]12C[C@@]3([H])[C@]4([H])CC[C@]([H])([C@@](C)(O)[C@@]5([H])CC(C)=C(C)C(=O)O5)[C@@]4(C)CC[C@]3([H])[C@@]3(C)C(=O)C=C[C@H](O)C13O2 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0003218 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|