| Primary information |
|---|
| ID | 20483 |
| Pubchem ID | 8956 |
| Name | 20alpha-Dihydroprogesterone |
| Description | 20alpha-Dihydroprogesterone is a biologically active 20-alpha-reduced metabolite of progesterone. It is converted from progesterone to 20-alpha-hydroxypregn-4-en-3-one by the 20-alpha-hydroxysteroid dehydrogenase in the corpus luteum and the placenta. |
| Synonym | (20S)-Hydroxypregn-4-en-3-one;(S)-20-Hydroxypregn-4-en-3-one;20alpha-Hydroxy-4-pregnen-3-one;20alpha-Hydroxypregn-4-en-3-one;20alpha-Hydroxyprogesterone;Dihydroprogesterone;20a-Hydroxy-4-pregnen-3-one |
| Molecular Weight | 316.4776 |
| Formula | C21H32O2 |
| IUPAC | (1S;2R;10S;11S;14S;15S)-14-[(1S)-1-hydroxyethyl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)O |
| PDB ID | NA |
| KEGG | C04042 |
| HMDB ID | HMDB0003069 |
| Melting Point (Degree C) | 126 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|