| Primary information |
|---|
| ID | 20482 |
| Pubchem ID | 122196 |
| Name | Triiodothyronine sulfate |
| Description | Triiodothyronine sulfate (T3S); also known as 3;5;3‘-triiodothyronine sulfate; is the sulfated conjugate of the thyroid hormone triiodothyronine (T3). T3; along with thyroxine (T4) are tyrosine-based hormones that are primarily responsible for regulation of metabolism. |
| Synonym | (2S)-2-Amino-3-{3;5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid;Triiodothyronine sulfuric ester;(2S)-2-Amino-3-{3;5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoate;(2S)-2-Amino-3 |
| Molecular Weight | 731.037 |
| Formula | C15H12I3NO7S |
| IUPAC | (2S)-2-amino-3-{3;5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid |
| SMILE | N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(OS(O)(=O)=O)C=C2)C(I)=C1)C(O)=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0003036 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|